C11H11N5O2 — CID 106394010
2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine (PubChem CID 106394010) has the molecular formula C11H11N5O2 and a molecular weight of 245.24 g/mol. Its IUPAC name is 2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 106394010 |
| Molecular Formula | C11H11N5O2 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-N-[2-(1,2,4-oxadiazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(NCCc3ncon3)oc2c1 |
| InChI | InChI=1S/C11H11N5O2/c12-7-1-2-8-9(5-7)18-11(15-8)13-4-3-10-14-6-17-16-10/h1-2,5-6H,3-4,12H2,(H,13,15) |
| InChIKey | CWCHACRAYLUCCI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|