C10H13N3O3 — CID 79893329
3-[(6-amino-1,3-benzoxazol-2-yl)amino]propane-1,2-diol (PubChem CID 79893329) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzoxazol-2-yl)amino]propane-1,2-diol.
| Compound Name | 3-[(6-amino-1,3-benzoxazol-2-yl)amino]propane-1,2-diol |
|---|---|
| PubChem CID | 79893329 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 3-[(6-amino-1,3-benzoxazol-2-yl)amino]propane-1,2-diol |
| SMILES | Nc1ccc2nc(NCC(O)CO)oc2c1 |
| InChI | InChI=1S/C10H13N3O3/c11-6-1-2-8-9(3-6)16-10(13-8)12-4-7(15)5-14/h1-3,7,14-15H,4-5,11H2,(H,12,13) |
| InChIKey | VFOAZMBIKFZLMT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|