C14H19F2N3S — CID 107935151
2,3-difluoro-4-(2-pyrrolidin-1-ylpropylamino)benzenecarbothioamide (PubChem CID 107935151) has the molecular formula C14H19F2N3S and a molecular weight of 299.39 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-pyrrolidin-1-ylpropylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(2-pyrrolidin-1-ylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107935151 |
| Molecular Formula | C14H19F2N3S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2,3-difluoro-4-(2-pyrrolidin-1-ylpropylamino)benzenecarbothioamide |
| SMILES | CC(CNc1ccc(C(N)=S)c(F)c1F)N1CCCC1 |
| InChI | InChI=1S/C14H19F2N3S/c1-9(19-6-2-3-7-19)8-18-11-5-4-10(14(17)20)12(15)13(11)16/h4-5,9,18H,2-3,6-8H2,1H3,(H2,17,20) |
| InChIKey | CGXHEBOMKJNISQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|