C11H14F2N2OS2 — CID 114017862
2,3-difluoro-4-(2-methylsulfinylpropylamino)benzenecarbothioamide (PubChem CID 114017862) has the molecular formula C11H14F2N2OS2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2,3-difluoro-4-(2-methylsulfinylpropylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(2-methylsulfinylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 114017862 |
| Molecular Formula | C11H14F2N2OS2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2,3-difluoro-4-(2-methylsulfinylpropylamino)benzenecarbothioamide |
| SMILES | CC(CNc1ccc(C(N)=S)c(F)c1F)S(C)=O |
| InChI | InChI=1S/C11H14F2N2OS2/c1-6(18(2)16)5-15-8-4-3-7(11(14)17)9(12)10(8)13/h3-4,6,15H,5H2,1-2H3,(H2,14,17) |
| InChIKey | ZJVQAEUKYUCKNR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|