C10H14F2N2O2 — CID 65310224
2-[4-amino-2-(difluoromethyl)anilino]propane-1,3-diol (PubChem CID 65310224) has the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-[4-amino-2-(difluoromethyl)anilino]propane-1,3-diol.
| Compound Name | 2-[4-amino-2-(difluoromethyl)anilino]propane-1,3-diol |
|---|---|
| PubChem CID | 65310224 |
| Molecular Formula | C10H14F2N2O2 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-[4-amino-2-(difluoromethyl)anilino]propane-1,3-diol |
| SMILES | Nc1ccc(NC(CO)CO)c(C(F)F)c1 |
| InChI | InChI=1S/C10H14F2N2O2/c11-10(12)8-3-6(13)1-2-9(8)14-7(4-15)5-16/h1-3,7,10,14-16H,4-5,13H2 |
| InChIKey | CWGZWLJWLCLNQF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|