C12H18F2N2O2 — CID 106153624
3-[4-amino-2-(difluoromethyl)anilino]-4-methoxybutan-1-ol (PubChem CID 106153624) has the molecular formula C12H18F2N2O2 and a molecular weight of 260.28 g/mol. Its IUPAC name is 3-[4-amino-2-(difluoromethyl)anilino]-4-methoxybutan-1-ol.
| Compound Name | 3-[4-amino-2-(difluoromethyl)anilino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106153624 |
| Molecular Formula | C12H18F2N2O2 |
| Molecular Weight | 260.28 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 3-[4-amino-2-(difluoromethyl)anilino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C12H18F2N2O2/c1-18-7-9(4-5-17)16-11-3-2-8(15)6-10(11)12(13)14/h2-3,6,9,12,16-17H,4-5,7,15H2,1H3 |
| InChIKey | UFOPEOCXYGUBNH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|