C13H19N3O2S — CID 106153751
3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methoxybutan-1-ol (PubChem CID 106153751) has the molecular formula C13H19N3O2S and a molecular weight of 281.38 g/mol. Its IUPAC name is 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methoxybutan-1-ol.
| Compound Name | 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methoxybutan-1-ol |
|---|---|
| PubChem CID | 106153751 |
| Molecular Formula | C13H19N3O2S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-[(6-amino-2-methyl-1,3-benzothiazol-5-yl)amino]-4-methoxybutan-1-ol |
| SMILES | COCC(CCO)Nc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C13H19N3O2S/c1-8-15-12-6-11(10(14)5-13(12)19-8)16-9(3-4-17)7-18-2/h5-6,9,16-17H,3-4,7,14H2,1-2H3 |
| InChIKey | NVXGKHGZTQGUDX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|