C13H19N3OS — CID 64602603
5-N-(4-methoxybutan-2-yl)-2-methyl-1,3-benzothiazole-5,6-diamine (PubChem CID 64602603) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 5-N-(4-methoxybutan-2-yl)-2-methyl-1,3-benzothiazole-5,6-diamine.
| Compound Name | 5-N-(4-methoxybutan-2-yl)-2-methyl-1,3-benzothiazole-5,6-diamine |
|---|---|
| PubChem CID | 64602603 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 5-N-(4-methoxybutan-2-yl)-2-methyl-1,3-benzothiazole-5,6-diamine |
| SMILES | COCCC(C)Nc1cc2nc(C)sc2cc1N |
| InChI | InChI=1S/C13H19N3OS/c1-8(4-5-17-3)15-11-7-12-13(6-10(11)14)18-9(2)16-12/h6-8,15H,4-5,14H2,1-3H3 |
| InChIKey | LOAIQZDJVZINQB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|