C11H12F2N2 — CID 60679330
5-(2,4-difluoroanilino)pentanenitrile (PubChem CID 60679330) has the molecular formula C11H12F2N2 and a molecular weight of 210.23 g/mol. Its IUPAC name is 5-(2,4-difluoroanilino)pentanenitrile.
| Compound Name | 5-(2,4-difluoroanilino)pentanenitrile |
|---|---|
| PubChem CID | 60679330 |
| Molecular Formula | C11H12F2N2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 5-(2,4-difluoroanilino)pentanenitrile |
| SMILES | N#CCCCCNc1ccc(F)cc1F |
| InChI | InChI=1S/C11H12F2N2/c12-9-4-5-11(10(13)8-9)15-7-3-1-2-6-14/h4-5,8,15H,1-3,7H2 |
| InChIKey | MCJHPESFSYDZPM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|