C11H18N4O2S — CID 80786198
2-N-(1,1-dioxothiolan-3-yl)-6-N-propylpyrazine-2,6-diamine (PubChem CID 80786198) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-N-(1,1-dioxothiolan-3-yl)-6-N-propylpyrazine-2,6-diamine.
| Compound Name | 2-N-(1,1-dioxothiolan-3-yl)-6-N-propylpyrazine-2,6-diamine |
|---|---|
| PubChem CID | 80786198 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-N-(1,1-dioxothiolan-3-yl)-6-N-propylpyrazine-2,6-diamine |
| SMILES | CCCNc1cncc(NC2CCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C11H18N4O2S/c1-2-4-13-10-6-12-7-11(15-10)14-9-3-5-18(16,17)8-9/h6-7,9H,2-5,8H2,1H3,(H2,13,14,15) |
| InChIKey | XCQWUKURTCKEMN-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |