C7H8Cl3N3O2 — CID 175183394
1,4-dioxane;2,4,6-trichloro-1,3,5-triazine (PubChem CID 175183394) has the molecular formula C7H8Cl3N3O2 and a molecular weight of 272.52 g/mol. Its IUPAC name is 1,4-dioxane;2,4,6-trichloro-1,3,5-triazine.
| Compound Name | 1,4-dioxane;2,4,6-trichloro-1,3,5-triazine |
|---|---|
| PubChem CID | 175183394 |
| Molecular Formula | C7H8Cl3N3O2 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | 1,4-dioxane;2,4,6-trichloro-1,3,5-triazine |
| SMILES | C1COCCO1.Clc1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C4H8O2.C3Cl3N3/c1-2-6-4-3-5-1;4-1-7-2(5)9-3(6)8-1/h1-4H2; |
| InChIKey | OAQYULLFXIDATJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |