C11H20N6 — CID 134257615
2-N-(4-methylcycloheptyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 134257615) has the molecular formula C11H20N6 and a molecular weight of 236.32 g/mol. Its IUPAC name is 2-N-(4-methylcycloheptyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-methylcycloheptyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 134257615 |
| Molecular Formula | C11H20N6 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 2-N-(4-methylcycloheptyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC1CCCC(Nc2nc(N)nc(N)n2)CC1 |
| InChI | InChI=1S/C11H20N6/c1-7-3-2-4-8(6-5-7)14-11-16-9(12)15-10(13)17-11/h7-8H,2-6H2,1H3,(H5,12,13,14,15,16,17) |
| InChIKey | MRXLUJFLHRWICT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |