C29H55N7O3 — CID 18993538
2-[2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol (PubChem CID 18993538) has the molecular formula C29H55N7O3 and a molecular weight of 549.81 g/mol. Its IUPAC name is 2-[2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 18993538 |
| Molecular Formula | C29H55N7O3 |
| Molecular Weight | 549.81 g/mol |
| Exact Mass | 549.44 |
| IUPAC Name | 2-[2-[[4,6-bis[ethyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]oxy]ethoxy]ethanol |
| SMILES | CCN(c1nc(OCCOCCO)nc(N(CC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C29H55N7O3/c1-11-35(21-17-26(3,4)33-27(5,6)18-21)23-30-24(32-25(31-23)39-16-15-38-14-13-37)36(12-2)22-19-28(7,8)34-29(9,10)20-22/h21-22,33-34,37H,11-20H2,1-10H3 |
| InChIKey | WGWHSXHZOGUDGA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.81 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|