C68H124N16O4-2 — CID 18993536
2,2-bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethyl]hexanedioate (PubChem CID 18993536) has the molecular formula C68H124N16O4-2 and a molecular weight of 1229.85 g/mol. Its IUPAC name is 2,2-bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethyl]hexanedioate.
| Compound Name | 2,2-bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethyl]hexanedioate |
|---|---|
| PubChem CID | 18993536 |
| Molecular Formula | C68H124N16O4-2 |
| Molecular Weight | 1229.85 g/mol |
| Exact Mass | 1229.00 |
| IUPAC Name | 2,2-bis[2-[[4,6-bis[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]amino]ethyl]hexanedioate |
| SMILES | CCCCN(c1nc(NCCC(CCCC(=O)[O-])(CCNc2nc(N(CCCC)C3CC(C)(C)NC(C)(C)C3)nc(N(CCCC)C3CC(C)(C)NC(C)(C)C3)n2)C(=O)[O-])nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C68H126N16O4/c1-21-25-36-81(48-40-60(5,6)77-61(7,8)41-48)56-71-54(72-57(75-56)82(37-26-22-2)49-42-62(9,10)78-63(11,12)43-49)69-34-32-68(53(87)88,31-29-30-52(85)86)33-35-70-55-73-58(83(38-27-23-3)50-44-64(13,14)79-65(15,16)45-50)76-59(74-55)84(39-28-24-4)51-46-66(17,18)80-67(19,20)47-51/h48-51,77-80H,21-47H2,1-20H3,(H,85,86)(H,87,88)(H,69,71,72,75)(H,70,73,74,76)/p-2 |
| InChIKey | PQLXLJNRKLWLCC-UHFFFAOYSA-L |
| XLogP | 9.68 |
| TPSA | 242.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 88 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1229.85 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |