C27H52N4O2 — CID 54259009
N-[5-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide (PubChem CID 54259009) has the molecular formula C27H52N4O2 and a molecular weight of 464.74 g/mol. Its IUPAC name is N-[5-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide.
| Compound Name | N-[5-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 54259009 |
| Molecular Formula | C27H52N4O2 |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.41 |
| IUPAC Name | N-[5-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]pentyl]-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide |
| SMILES | CC(=O)N(CCCCCN(C(C)=O)C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C27H52N4O2/c1-20(32)30(22-16-24(3,4)28-25(5,6)17-22)14-12-11-13-15-31(21(2)33)23-18-26(7,8)29-27(9,10)19-23/h22-23,28-29H,11-19H2,1-10H3 |
| InChIKey | IVDWAGMHTRVKQI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|