C32H60N4O4-2 — CID 87648886
N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexanediamide (PubChem CID 87648886) has the molecular formula C32H60N4O4-2 and a molecular weight of 564.86 g/mol. Its IUPAC name is N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexanediamide.
| Compound Name | N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexanediamide |
|---|---|
| PubChem CID | 87648886 |
| Molecular Formula | C32H60N4O4-2 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.46 |
| IUPAC Name | N,N'-dibutyl-N,N'-bis(2,2,6,6-tetramethyl-1-oxidopiperidin-4-yl)hexanediamide |
| SMILES | CCCCN(C(=O)CCCCC(=O)N(CCCC)C1CC(C)(C)N([O-])C(C)(C)C1)C1CC(C)(C)N([O-])C(C)(C)C1 |
| InChI | InChI=1S/C32H60N4O4/c1-11-13-19-33(25-21-29(3,4)35(39)30(5,6)22-25)27(37)17-15-16-18-28(38)34(20-14-12-2)26-23-31(7,8)36(40)32(9,10)24-26/h25-26H,11-24H2,1-10H3/q-2 |
| InChIKey | FXDYSOGAJXXMES-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|