C26H50N4O2 — CID 22323174
2,2,6,6-tetramethyl-N-[6-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]hexyl]piperidine-4-carboxamide (PubChem CID 22323174) has the molecular formula C26H50N4O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-N-[6-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]hexyl]piperidine-4-carboxamide.
| Compound Name | 2,2,6,6-tetramethyl-N-[6-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]hexyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 22323174 |
| Molecular Formula | C26H50N4O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.39 |
| IUPAC Name | 2,2,6,6-tetramethyl-N-[6-[(2,2,6,6-tetramethylpiperidine-4-carbonyl)amino]hexyl]piperidine-4-carboxamide |
| SMILES | CC1(C)CC(C(=O)NCCCCCCNC(=O)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C26H50N4O2/c1-23(2)15-19(16-24(3,4)29-23)21(31)27-13-11-9-10-12-14-28-22(32)20-17-25(5,6)30-26(7,8)18-20/h19-20,29-30H,9-18H2,1-8H3,(H,27,31)(H,28,32) |
| InChIKey | BCBGEMJMQQZQOB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|