C16H29N3O — CID 107857142
2-cyano-2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide (PubChem CID 107857142) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-cyano-2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide.
| Compound Name | 2-cyano-2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
|---|---|
| PubChem CID | 107857142 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 2-cyano-2-ethyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)butanamide |
| SMILES | CCC(C#N)(CC)C(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H29N3O/c1-7-16(8-2,11-17)13(20)18-12-9-14(3,4)19-15(5,6)10-12/h12,19H,7-10H2,1-6H3,(H,18,20) |
| InChIKey | CPNWHSSLAMJKCD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |