C15H28N2O2 — CID 5371382
ethyl (Z)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate (PubChem CID 5371382) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is ethyl (Z)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate.
| Compound Name | ethyl (Z)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate |
|---|---|
| PubChem CID | 5371382 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | ethyl (Z)-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/C)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H28N2O2/c1-7-19-13(18)8-11(2)16-12-9-14(3,4)17-15(5,6)10-12/h8,12,16-17H,7,9-10H2,1-6H3/b11-8- |
| InChIKey | TYIHVGIUNRELAO-FLIBITNWSA-N |
| XLogP | 2.35 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|