C16H25BrN6O2 — CID 54416370
ethyl 2-[[4-bromo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]imino]acetate (PubChem CID 54416370) has the molecular formula C16H25BrN6O2 and a molecular weight of 413.32 g/mol. Its IUPAC name is ethyl 2-[[4-bromo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]imino]acetate.
| Compound Name | ethyl 2-[[4-bromo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]imino]acetate |
|---|---|
| PubChem CID | 54416370 |
| Molecular Formula | C16H25BrN6O2 |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | ethyl 2-[[4-bromo-6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]imino]acetate |
| SMILES | CCOC(=O)C=Nc1nc(Br)nc(NC2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C16H25BrN6O2/c1-6-25-11(24)9-18-13-20-12(17)21-14(22-13)19-10-7-15(2,3)23-16(4,5)8-10/h9-10,23H,6-8H2,1-5H3,(H,19,20,21,22) |
| InChIKey | VXSMEPXCHWZYLN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|