C30H34F3N3O4 — CID 171928705
1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 171928705) has the molecular formula C30H34F3N3O4 and a molecular weight of 557.61 g/mol. Its IUPAC name is 1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171928705 |
| Molecular Formula | C30H34F3N3O4 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 1-benzyl-3-[(1S)-7-oxo-1-(4-phenyl-2-pyridinyl)nonyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)NCc1ccccc1)c1cc(-c2ccccc2)ccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H33N3O2.C2HF3O2/c1-2-25(32)16-10-5-11-17-26(31-28(33)30-21-22-12-6-3-7-13-22)27-20-24(18-19-29-27)23-14-8-4-9-15-23;3-2(4,5)1(6)7/h3-4,6-9,12-15,18-20,26H,2,5,10-11,16-17,21H2,1H3,(H2,30,31,33);(H,6,7)/t26-;/m0./s1 |
| InChIKey | SQLLJJLIVGDEBR-SNYZSRNZSA-N |
| XLogP | 6.85 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|