C30H40F6N4O6 — CID 141255021
dimethylamino-[2-methyl-1-oxo-1-[[(1S)-7-oxo-1-(4-phenylpyridin-1-ium-2-yl)nonyl]amino]propan-2-yl]azanium;bis(2,2,2-trifluoroacetate) (PubChem CID 141255021) has the molecular formula C30H40F6N4O6 and a molecular weight of 666.66 g/mol. Its IUPAC name is dimethylamino-[2-methyl-1-oxo-1-[[(1S)-7-oxo-1-(4-phenylpyridin-1-ium-2-yl)nonyl]amino]propan-2-yl]azanium;bis(2,2,2-trifluoroacetate).
| Compound Name | dimethylamino-[2-methyl-1-oxo-1-[[(1S)-7-oxo-1-(4-phenylpyridin-1-ium-2-yl)nonyl]amino]propan-2-yl]azanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 141255021 |
| Molecular Formula | C30H40F6N4O6 |
| Molecular Weight | 666.66 g/mol |
| Exact Mass | 666.29 |
| IUPAC Name | dimethylamino-[2-methyl-1-oxo-1-[[(1S)-7-oxo-1-(4-phenylpyridin-1-ium-2-yl)nonyl]amino]propan-2-yl]azanium;bis(2,2,2-trifluoroacetate) |
| SMILES | CCC(=O)CCCCC[C@H](NC(=O)C(C)(C)[NH2+]N(C)C)c1cc(-c2ccccc2)cc[nH+]1.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H38N4O2.2C2HF3O2/c1-6-22(31)15-11-8-12-16-23(28-25(32)26(2,3)29-30(4)5)24-19-21(17-18-27-24)20-13-9-7-10-14-20;2*3-2(4,5)1(6)7/h7,9-10,13-14,17-19,23,29H,6,8,11-12,15-16H2,1-5H3,(H,28,32);2*(H,6,7)/t23-;;/m0../s1 |
| InChIKey | NPKXFMCQSMBMBC-IFUPQEAVSA-N |
| XLogP | 1.67 |
| TPSA | 160.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.66 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|