C31H34F3N5O4 — CID 67267925
(7S)-7-(benzylcarbamoylamino)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-3-ium-2-yl)heptanamide;2,2,2-trifluoroacetate (PubChem CID 67267925) has the molecular formula C31H34F3N5O4 and a molecular weight of 597.64 g/mol. Its IUPAC name is (7S)-7-(benzylcarbamoylamino)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-3-ium-2-yl)heptanamide;2,2,2-trifluoroacetate.
| Compound Name | (7S)-7-(benzylcarbamoylamino)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-3-ium-2-yl)heptanamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 67267925 |
| Molecular Formula | C31H34F3N5O4 |
| Molecular Weight | 597.64 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | (7S)-7-(benzylcarbamoylamino)-N-methyl-7-(5-naphthalen-2-yl-1H-imidazol-3-ium-2-yl)heptanamide;2,2,2-trifluoroacetate |
| SMILES | CNC(=O)CCCCC[C@H](NC(=O)NCc1ccccc1)c1[nH]c(-c2ccc3ccccc3c2)c[nH+]1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C29H33N5O2.C2HF3O2/c1-30-27(35)15-7-3-6-14-25(34-29(36)32-19-21-10-4-2-5-11-21)28-31-20-26(33-28)24-17-16-22-12-8-9-13-23(22)18-24;3-2(4,5)1(6)7/h2,4-5,8-13,16-18,20,25H,3,6-7,14-15,19H2,1H3,(H,30,35)(H,31,33)(H2,32,34,36);(H,6,7)/t25-;/m0./s1 |
| InChIKey | RGDYYZABWAEBLN-UQIIZPHYSA-N |
| XLogP | 4.18 |
| TPSA | 140.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|