C31H51GdN5O4-2 — CID 162282378
2-[4-(9-benzamido-3-oxodecyl)-7,10-di(ethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium (PubChem CID 162282378) has the molecular formula C31H51GdN5O4-2 and a molecular weight of 715.03 g/mol. Its IUPAC name is 2-[4-(9-benzamido-3-oxodecyl)-7,10-di(ethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium.
| Compound Name | 2-[4-(9-benzamido-3-oxodecyl)-7,10-di(ethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium |
|---|---|
| PubChem CID | 162282378 |
| Molecular Formula | C31H51GdN5O4-2 |
| Molecular Weight | 715.03 g/mol |
| Exact Mass | 715.32 |
| IUPAC Name | 2-[4-(9-benzamido-3-oxodecyl)-7,10-di(ethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;gadolinium |
| SMILES | [CH2-]CN1CCN(C[CH2-])CCN(CC(=O)O)CCN(CCC(=O)CCCCCC(C)NC(=O)c2ccccc2)CC1.[Gd] |
| InChI | InChI=1S/C31H51N5O4.Gd/c1-4-33-18-19-34(5-2)21-24-36(26-30(38)39)25-23-35(22-20-33)17-16-29(37)15-11-6-8-12-27(3)32-31(40)28-13-9-7-10-14-28;/h7,9-10,13-14,27H,1-2,4-6,8,11-12,15-26H2,3H3,(H,32,40)(H,38,39);/q-2; |
| InChIKey | FOSBTZKSKUQLGI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.03 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|