C28H32N4O4S — CID 11466533
4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(4-phenylanilino)propan-2-yl]benzamide (PubChem CID 11466533) has the molecular formula C28H32N4O4S and a molecular weight of 520.66 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(4-phenylanilino)propan-2-yl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(4-phenylanilino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 11466533 |
| Molecular Formula | C28H32N4O4S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | 4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(4-phenylanilino)propan-2-yl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)N[C@@H](CSCCCC(=O)NO)C(=O)Nc2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O4S/c1-32(2)24-16-12-22(13-17-24)27(34)30-25(19-37-18-6-9-26(33)31-36)28(35)29-23-14-10-21(11-15-23)20-7-4-3-5-8-20/h3-5,7-8,10-17,25,36H,6,9,18-19H2,1-2H3,(H,29,35)(H,30,34)(H,31,33)/t25-/m0/s1 |
| InChIKey | GCKJYGRBLUDRMY-VWLOTQADSA-N |
| XLogP | 4.18 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|