C26H34N4O4S — CID 11752361
4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]benzamide (PubChem CID 11752361) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]benzamide.
| Compound Name | 4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 11752361 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 4-(dimethylamino)-N-[(2R)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxo-1-(1,2,3,4-tetrahydronaphthalen-1-ylamino)propan-2-yl]benzamide |
| SMILES | CN(C)c1ccc(C(=O)N[C@@H](CSCCCC(=O)NO)C(=O)NC2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C26H34N4O4S/c1-30(2)20-14-12-19(13-15-20)25(32)28-23(17-35-16-6-11-24(31)29-34)26(33)27-22-10-5-8-18-7-3-4-9-21(18)22/h3-4,7,9,12-15,22-23,34H,5-6,8,10-11,16-17H2,1-2H3,(H,27,33)(H,28,32)(H,29,31)/t22?,23-/m0/s1 |
| InChIKey | HDTQGDOXNFVXQB-WCSIJFPASA-N |
| XLogP | 3.06 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|