C20H26ClN3O — CID 19936132
1-[4-(dimethylamino)phenyl]-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride (PubChem CID 19936132) has the molecular formula C20H26ClN3O and a molecular weight of 359.90 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride |
|---|---|
| PubChem CID | 19936132 |
| Molecular Formula | C20H26ClN3O |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride |
| SMILES | CN(C)c1ccc(NC(=O)NC2CCCCc3ccccc32)cc1.Cl |
| InChI | InChI=1S/C20H25N3O.ClH/c1-23(2)17-13-11-16(12-14-17)21-20(24)22-19-10-6-4-8-15-7-3-5-9-18(15)19;/h3,5,7,9,11-14,19H,4,6,8,10H2,1-2H3,(H2,21,22,24);1H |
| InChIKey | DGEQBBSKUPOYRC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|