C19H23N3O3S — CID 47032068
1-[3-(dimethylsulfamoyl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea (PubChem CID 47032068) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 1-[3-(dimethylsulfamoyl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 47032068 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-[3-(dimethylsulfamoyl)phenyl]-3-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
| SMILES | CN(C)S(=O)(=O)c1cccc(NC(=O)NC2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-22(2)26(24,25)16-10-6-9-15(13-16)20-19(23)21-18-12-5-8-14-7-3-4-11-17(14)18/h3-4,6-7,9-11,13,18H,5,8,12H2,1-2H3,(H2,20,21,23) |
| InChIKey | HLTURLGCQDGOPA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |