C27H38ClN3O — CID 19785673
1-cycloheptyl-3-[4-(dimethylamino)phenyl]-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride (PubChem CID 19785673) has the molecular formula C27H38ClN3O and a molecular weight of 456.07 g/mol. Its IUPAC name is 1-cycloheptyl-3-[4-(dimethylamino)phenyl]-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride.
| Compound Name | 1-cycloheptyl-3-[4-(dimethylamino)phenyl]-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride |
|---|---|
| PubChem CID | 19785673 |
| Molecular Formula | C27H38ClN3O |
| Molecular Weight | 456.07 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 1-cycloheptyl-3-[4-(dimethylamino)phenyl]-1-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)urea;hydrochloride |
| SMILES | CN(C)c1ccc(NC(=O)N(C2CCCCCC2)C2CCCCc3ccccc32)cc1.Cl |
| InChI | InChI=1S/C27H37N3O.ClH/c1-29(2)23-19-17-22(18-20-23)28-27(31)30(24-13-5-3-4-6-14-24)26-16-10-8-12-21-11-7-9-15-25(21)26;/h7,9,11,15,17-20,24,26H,3-6,8,10,12-14,16H2,1-2H3,(H,28,31);1H |
| InChIKey | ISWRJDGYPMVMFY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.07 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|