C20H27N5O — CID 127826932
3-(1-tert-butyl-1,2,4-triazol-3-yl)-1-cyclopropyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)urea (PubChem CID 127826932) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-(1-tert-butyl-1,2,4-triazol-3-yl)-1-cyclopropyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)urea.
| Compound Name | 3-(1-tert-butyl-1,2,4-triazol-3-yl)-1-cyclopropyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 127826932 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 3-(1-tert-butyl-1,2,4-triazol-3-yl)-1-cyclopropyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)urea |
| SMILES | CC(C)(C)n1cnc(NC(=O)N(C2CC2)C2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C20H27N5O/c1-20(2,3)24-13-21-18(23-24)22-19(26)25(15-11-12-15)17-10-6-8-14-7-4-5-9-16(14)17/h4-5,7,9,13,15,17H,6,8,10-12H2,1-3H3,(H,22,23,26) |
| InChIKey | LFKJEJQWCCOCSI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |