C22H34N2O — CID 4171224
1,1-dicyclohexyl-3-(4-propan-2-ylphenyl)urea (PubChem CID 4171224) has the molecular formula C22H34N2O and a molecular weight of 342.53 g/mol. Its IUPAC name is 1,1-dicyclohexyl-3-(4-propan-2-ylphenyl)urea.
| Compound Name | 1,1-dicyclohexyl-3-(4-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 4171224 |
| Molecular Formula | C22H34N2O |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 1,1-dicyclohexyl-3-(4-propan-2-ylphenyl)urea |
| SMILES | CC(C)c1ccc(NC(=O)N(C2CCCCC2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H34N2O/c1-17(2)18-13-15-19(16-14-18)23-22(25)24(20-9-5-3-6-10-20)21-11-7-4-8-12-21/h13-17,20-21H,3-12H2,1-2H3,(H,23,25) |
| InChIKey | LWPVWCBEEORONK-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |