C18H29N2O+ — CID 8875930
cyclopentyl-dimethyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium (PubChem CID 8875930) has the molecular formula C18H29N2O+ and a molecular weight of 289.44 g/mol. Its IUPAC name is cyclopentyl-dimethyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium.
| Compound Name | cyclopentyl-dimethyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8875930 |
| Molecular Formula | C18H29N2O+ |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | cyclopentyl-dimethyl-[2-oxo-2-(4-propan-2-ylanilino)ethyl]azanium |
| SMILES | CC(C)c1ccc(NC(=O)C[N+](C)(C)C2CCCC2)cc1 |
| InChI | InChI=1S/C18H28N2O/c1-14(2)15-9-11-16(12-10-15)19-18(21)13-20(3,4)17-7-5-6-8-17/h9-12,14,17H,5-8,13H2,1-4H3/p+1 |
| InChIKey | POJCRNULKUOWLA-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|