C30H32N4O4S — CID 11192003
N-[(2R)-1-(anthracen-1-ylamino)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxopropan-2-yl]-4-(dimethylamino)benzamide (PubChem CID 11192003) has the molecular formula C30H32N4O4S and a molecular weight of 544.68 g/mol. Its IUPAC name is N-[(2R)-1-(anthracen-1-ylamino)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxopropan-2-yl]-4-(dimethylamino)benzamide.
| Compound Name | N-[(2R)-1-(anthracen-1-ylamino)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxopropan-2-yl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 11192003 |
| Molecular Formula | C30H32N4O4S |
| Molecular Weight | 544.68 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | N-[(2R)-1-(anthracen-1-ylamino)-3-[4-(hydroxyamino)-4-oxobutyl]sulfanyl-1-oxopropan-2-yl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)N[C@@H](CSCCCC(=O)NO)C(=O)Nc2cccc3cc4ccccc4cc23)cc1 |
| InChI | InChI=1S/C30H32N4O4S/c1-34(2)24-14-12-20(13-15-24)29(36)32-27(19-39-16-6-11-28(35)33-38)30(37)31-26-10-5-9-23-17-21-7-3-4-8-22(21)18-25(23)26/h3-5,7-10,12-15,17-18,27,38H,6,11,16,19H2,1-2H3,(H,31,37)(H,32,36)(H,33,35)/t27-/m0/s1 |
| InChIKey | JHIWRQWDWWKGKZ-MHZLTWQESA-N |
| XLogP | 4.81 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|