C21H17N5O3 — CID 6723510
N-[(2S)-3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]quinoxaline-2-carboxamide (PubChem CID 6723510) has the molecular formula C21H17N5O3 and a molecular weight of 387.40 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]quinoxaline-2-carboxamide.
| Compound Name | N-[(2S)-3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 6723510 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-oxo-1-(quinolin-6-ylamino)propan-2-yl]quinoxaline-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)C(=O)Nc1ccc2ncccc2c1)c1cnc2ccccc2n1 |
| InChI | InChI=1S/C21H17N5O3/c27-12-19(21(29)24-14-7-8-15-13(10-14)4-3-9-22-15)26-20(28)18-11-23-16-5-1-2-6-17(16)25-18/h1-11,19,27H,12H2,(H,24,29)(H,26,28)/t19-/m0/s1 |
| InChIKey | OHXHJGVQXKTRLV-IBGZPJMESA-N |
| XLogP | 1.91 |
| TPSA | 117.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |