About [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate
[(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate (PubChem CID 95616020) has the molecular formula C12H8F3NO3
and a molecular weight of 271.19 g/mol. Its IUPAC name is [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate.
Analyze [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate?
The IUPAC name of [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate (CID 95616020) is [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate.
What is the SMILES notation for [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate?
The canonical SMILES for [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate is O=C(O[C@@H](c1cccnc1)C(F)(F)F)c1ccco1.
What is the InChIKey of [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate?
The InChIKey is MEESEVNSSKQADX-JTQLQIEISA-N. The full InChI is InChI=1S/C12H8F3NO3/c13-12(14,15)10(8-3-1-5-16-7-8)19-11(17)9-4-2-6-18-9/h1-7,10H/t10-/m0/s1.
What are the key properties of [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate?
[(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate has a molecular weight of 271.19 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2,2-trifluoro-1-pyridin-3-ylethyl] furan-2-carboxylate is sourced from PubChem (CID 95616020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).