C11H8F3NO4S — CID 167743029
(2,2,2-trifluoro-1-pyridin-3-ylethyl) furan-2-sulfonate (PubChem CID 167743029) has the molecular formula C11H8F3NO4S and a molecular weight of 307.25 g/mol. Its IUPAC name is (2,2,2-trifluoro-1-pyridin-3-ylethyl) furan-2-sulfonate.
| Compound Name | (2,2,2-trifluoro-1-pyridin-3-ylethyl) furan-2-sulfonate |
|---|---|
| PubChem CID | 167743029 |
| Molecular Formula | C11H8F3NO4S |
| Molecular Weight | 307.25 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | (2,2,2-trifluoro-1-pyridin-3-ylethyl) furan-2-sulfonate |
| SMILES | O=S(=O)(OC(c1cccnc1)C(F)(F)F)c1ccco1 |
| InChI | InChI=1S/C11H8F3NO4S/c12-11(13,14)10(8-3-1-5-15-7-8)19-20(16,17)9-4-2-6-18-9/h1-7,10H |
| InChIKey | OHBGNFPWURZSGX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|