C15H11F3N4O — CID 150800960
3-(2,2,2-trifluoro-1-pyridin-3-ylethoxy)-1,7-naphthyridin-2-amine (PubChem CID 150800960) has the molecular formula C15H11F3N4O and a molecular weight of 320.27 g/mol. Its IUPAC name is 3-(2,2,2-trifluoro-1-pyridin-3-ylethoxy)-1,7-naphthyridin-2-amine.
| Compound Name | 3-(2,2,2-trifluoro-1-pyridin-3-ylethoxy)-1,7-naphthyridin-2-amine |
|---|---|
| PubChem CID | 150800960 |
| Molecular Formula | C15H11F3N4O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 3-(2,2,2-trifluoro-1-pyridin-3-ylethoxy)-1,7-naphthyridin-2-amine |
| SMILES | Nc1nc2cnccc2cc1OC(c1cccnc1)C(F)(F)F |
| InChI | InChI=1S/C15H11F3N4O/c16-15(17,18)13(10-2-1-4-20-7-10)23-12-6-9-3-5-21-8-11(9)22-14(12)19/h1-8,13H,(H2,19,22) |
| InChIKey | KFVUGHCBIRFUJN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |