C29H30N2O9 — CID 134422478
methyl 4-[[[(2R,3R)-2-acetyloxy-3-(1-hydroxyethoxy)-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]methyl]benzoate (PubChem CID 134422478) has the molecular formula C29H30N2O9 and a molecular weight of 550.56 g/mol. Its IUPAC name is methyl 4-[[[(2R,3R)-2-acetyloxy-3-(1-hydroxyethoxy)-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(2R,3R)-2-acetyloxy-3-(1-hydroxyethoxy)-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 134422478 |
| Molecular Formula | C29H30N2O9 |
| Molecular Weight | 550.56 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | methyl 4-[[[(2R,3R)-2-acetyloxy-3-(1-hydroxyethoxy)-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)[C@H](OC(C)=O)[C@@H](OC(C)O)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H30N2O9/c1-18(32)38-25(27(34)30-17-20-9-11-21(12-10-20)29(36)37-3)26(39-19(2)33)28(35)31-22-13-15-24(16-14-22)40-23-7-5-4-6-8-23/h4-16,19,25-26,33H,17H2,1-3H3,(H,30,34)(H,31,35)/t19?,25-,26-/m1/s1 |
| InChIKey | LEKYPLZYNBOGAY-VTFDQJKESA-N |
| XLogP | 3.18 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.56 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|