C31H30N2O5 — CID 90783614
methyl 4-[[[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]methyl]benzoate (PubChem CID 90783614) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is methyl 4-[[[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 90783614 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | methyl 4-[[[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(COCc2ccccc2)C(=O)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H30N2O5/c1-36-31(35)25-14-12-23(13-15-25)20-32-29(22-37-21-24-8-4-2-5-9-24)30(34)33-26-16-18-28(19-17-26)38-27-10-6-3-7-11-27/h2-19,29,32H,20-22H2,1H3,(H,33,34) |
| InChIKey | UQLIISBIJSYZJQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |