C25H26N5O4- — CID 143978875
[(Z)-azanidylmethylidene-[2-oxo-2-[[(2S)-1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]ethyl]azaniumyl]azanide (PubChem CID 143978875) has the molecular formula C25H26N5O4- and a molecular weight of 460.51 g/mol. Its IUPAC name is [(Z)-azanidylmethylidene-[2-oxo-2-[[(2S)-1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]ethyl]azaniumyl]azanide.
| Compound Name | [(Z)-azanidylmethylidene-[2-oxo-2-[[(2S)-1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]ethyl]azaniumyl]azanide |
|---|---|
| PubChem CID | 143978875 |
| Molecular Formula | C25H26N5O4- |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | [(Z)-azanidylmethylidene-[2-oxo-2-[[(2S)-1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]amino]ethyl]azaniumyl]azanide |
| SMILES | [NH-]/C=[N+](\[NH-])CC(=O)N[C@@H](COCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N5O4/c26-18-30(27)15-24(31)29-23(17-33-16-19-7-3-1-4-8-19)25(32)28-20-11-13-22(14-12-20)34-21-9-5-2-6-10-21/h1-14,18,23,26-27H,15-17H2,(H,28,32)(H,29,31)/q-1/b30-18-,30-27?/t23-/m0/s1 |
| InChIKey | MQHUUTJBUXAGLX-GSHFVTKRSA-N |
| XLogP | 4.18 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|