C24H22ClFN2O4 — CID 67010267
2-[(2-chloroacetyl)amino]-N-[4-(4-fluorophenoxy)phenyl]-3-phenylmethoxypropanamide (PubChem CID 67010267) has the molecular formula C24H22ClFN2O4 and a molecular weight of 456.90 g/mol. Its IUPAC name is 2-[(2-chloroacetyl)amino]-N-[4-(4-fluorophenoxy)phenyl]-3-phenylmethoxypropanamide.
| Compound Name | 2-[(2-chloroacetyl)amino]-N-[4-(4-fluorophenoxy)phenyl]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 67010267 |
| Molecular Formula | C24H22ClFN2O4 |
| Molecular Weight | 456.90 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | 2-[(2-chloroacetyl)amino]-N-[4-(4-fluorophenoxy)phenyl]-3-phenylmethoxypropanamide |
| SMILES | O=C(CCl)NC(COCc1ccccc1)C(=O)Nc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H22ClFN2O4/c25-14-23(29)28-22(16-31-15-17-4-2-1-3-5-17)24(30)27-19-8-12-21(13-9-19)32-20-10-6-18(26)7-11-20/h1-13,22H,14-16H2,(H,27,30)(H,28,29) |
| InChIKey | DGDCNZZOVWZXOF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|