C26H27FN5O4+ — CID 143979254
[(2Z)-2-[[2-[[(2S)-1-[4-(4-fluorophenoxy)anilino]-1-oxo-3-phenylmethoxypropan-2-yl]amino]-2-oxoethyl]hydrazinylidene]ethylidene]azanium (PubChem CID 143979254) has the molecular formula C26H27FN5O4+ and a molecular weight of 492.53 g/mol. Its IUPAC name is [(2Z)-2-[[2-[[(2S)-1-[4-(4-fluorophenoxy)anilino]-1-oxo-3-phenylmethoxypropan-2-yl]amino]-2-oxoethyl]hydrazinylidene]ethylidene]azanium.
| Compound Name | [(2Z)-2-[[2-[[(2S)-1-[4-(4-fluorophenoxy)anilino]-1-oxo-3-phenylmethoxypropan-2-yl]amino]-2-oxoethyl]hydrazinylidene]ethylidene]azanium |
|---|---|
| PubChem CID | 143979254 |
| Molecular Formula | C26H27FN5O4+ |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | [(2Z)-2-[[2-[[(2S)-1-[4-(4-fluorophenoxy)anilino]-1-oxo-3-phenylmethoxypropan-2-yl]amino]-2-oxoethyl]hydrazinylidene]ethylidene]azanium |
| SMILES | [NH2+]=C/C=N\NCC(=O)N[C@@H](COCc1ccccc1)C(=O)Nc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H26FN5O4/c27-20-6-10-22(11-7-20)36-23-12-8-21(9-13-23)31-26(34)24(32-25(33)16-30-29-15-14-28)18-35-17-19-4-2-1-3-5-19/h1-15,24,28,30H,16-18H2,(H,31,34)(H,32,33)/p+1/b28-14?,29-15-/t24-/m0/s1 |
| InChIKey | BBTOFKPPJUTCFY-ALQFLERDSA-O |
| XLogP | 1.66 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|