C29H30FN5O4 — CID 67009447
N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[2-(1H-imidazol-5-yl)ethylamino]acetyl]amino]-3-phenylmethoxypropanamide (PubChem CID 67009447) has the molecular formula C29H30FN5O4 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[2-(1H-imidazol-5-yl)ethylamino]acetyl]amino]-3-phenylmethoxypropanamide.
| Compound Name | N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[2-(1H-imidazol-5-yl)ethylamino]acetyl]amino]-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 67009447 |
| Molecular Formula | C29H30FN5O4 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | N-[4-(4-fluorophenoxy)phenyl]-2-[[2-[2-(1H-imidazol-5-yl)ethylamino]acetyl]amino]-3-phenylmethoxypropanamide |
| SMILES | O=C(CNCCc1cnc[nH]1)NC(COCc1ccccc1)C(=O)Nc1ccc(Oc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H30FN5O4/c30-22-6-10-25(11-7-22)39-26-12-8-23(9-13-26)34-29(37)27(19-38-18-21-4-2-1-3-5-21)35-28(36)17-31-15-14-24-16-32-20-33-24/h1-13,16,20,27,31H,14-15,17-19H2,(H,32,33)(H,34,37)(H,35,36) |
| InChIKey | BVEXKQFSBFYUTG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|