C30H27ClN2O4 — CID 67009628
2-[[2-(3-chlorophenyl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide (PubChem CID 67009628) has the molecular formula C30H27ClN2O4 and a molecular weight of 515.01 g/mol. Its IUPAC name is 2-[[2-(3-chlorophenyl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide.
| Compound Name | 2-[[2-(3-chlorophenyl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 67009628 |
| Molecular Formula | C30H27ClN2O4 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | 2-[[2-(3-chlorophenyl)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide |
| SMILES | O=C(Cc1cccc(Cl)c1)NC(COCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H27ClN2O4/c31-24-11-7-10-23(18-24)19-29(34)33-28(21-36-20-22-8-3-1-4-9-22)30(35)32-25-14-16-27(17-15-25)37-26-12-5-2-6-13-26/h1-18,28H,19-21H2,(H,32,35)(H,33,34) |
| InChIKey | BICMBPHYYCDOIW-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |