C30H28N2O6 — CID 70641256
2-[[2-(2-hydroxyphenoxy)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide (PubChem CID 70641256) has the molecular formula C30H28N2O6 and a molecular weight of 512.56 g/mol. Its IUPAC name is 2-[[2-(2-hydroxyphenoxy)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide.
| Compound Name | 2-[[2-(2-hydroxyphenoxy)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 70641256 |
| Molecular Formula | C30H28N2O6 |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 2-[[2-(2-hydroxyphenoxy)acetyl]amino]-N-(4-phenoxyphenyl)-3-phenylmethoxypropanamide |
| SMILES | O=C(COc1ccccc1O)NC(COCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C30H28N2O6/c33-27-13-7-8-14-28(27)37-21-29(34)32-26(20-36-19-22-9-3-1-4-10-22)30(35)31-23-15-17-25(18-16-23)38-24-11-5-2-6-12-24/h1-18,26,33H,19-21H2,(H,31,35)(H,32,34) |
| InChIKey | DLTPQEMHNGBZFF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |