C27H23N3O7 — CID 89078446
5-nitro-N-[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]furan-2-carboxamide (PubChem CID 89078446) has the molecular formula C27H23N3O7 and a molecular weight of 501.50 g/mol. Its IUPAC name is 5-nitro-N-[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]furan-2-carboxamide.
| Compound Name | 5-nitro-N-[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 89078446 |
| Molecular Formula | C27H23N3O7 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | 5-nitro-N-[1-oxo-1-(4-phenoxyanilino)-3-phenylmethoxypropan-2-yl]furan-2-carboxamide |
| SMILES | O=C(NC(COCc1ccccc1)C(=O)Nc1ccc(Oc2ccccc2)cc1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C27H23N3O7/c31-26(28-20-11-13-22(14-12-20)36-21-9-5-2-6-10-21)23(18-35-17-19-7-3-1-4-8-19)29-27(32)24-15-16-25(37-24)30(33)34/h1-16,23H,17-18H2,(H,28,31)(H,29,32) |
| InChIKey | GVYMPXNDIYCFLT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|