C28H32N2O9 — CID 68785971
methyl 4-[[(2R,3R)-2,3-diacetyloxy-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]cyclohexane-1-carboxylate (PubChem CID 68785971) has the molecular formula C28H32N2O9 and a molecular weight of 540.57 g/mol. Its IUPAC name is methyl 4-[[(2R,3R)-2,3-diacetyloxy-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[[(2R,3R)-2,3-diacetyloxy-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 68785971 |
| Molecular Formula | C28H32N2O9 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | methyl 4-[[(2R,3R)-2,3-diacetyloxy-4-oxo-4-(4-phenoxyanilino)butanoyl]amino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(NC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)Nc2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C28H32N2O9/c1-17(31)37-24(26(33)29-20-11-9-19(10-12-20)28(35)36-3)25(38-18(2)32)27(34)30-21-13-15-23(16-14-21)39-22-7-5-4-6-8-22/h4-8,13-16,19-20,24-25H,9-12H2,1-3H3,(H,29,33)(H,30,34)/t19?,20?,24-,25-/m1/s1 |
| InChIKey | OUFOVQBDWONHCB-LTBUFCQKSA-N |
| XLogP | 3.13 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|