C13H21NO7 — CID 82036737
2,3-diacetyloxy-4-oxo-4-(pentylamino)butanoic acid (PubChem CID 82036737) has the molecular formula C13H21NO7 and a molecular weight of 303.31 g/mol. Its IUPAC name is 2,3-diacetyloxy-4-oxo-4-(pentylamino)butanoic acid.
| Compound Name | 2,3-diacetyloxy-4-oxo-4-(pentylamino)butanoic acid |
|---|---|
| PubChem CID | 82036737 |
| Molecular Formula | C13H21NO7 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2,3-diacetyloxy-4-oxo-4-(pentylamino)butanoic acid |
| SMILES | CCCCCNC(=O)C(OC(C)=O)C(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C13H21NO7/c1-4-5-6-7-14-12(17)10(20-8(2)15)11(13(18)19)21-9(3)16/h10-11H,4-7H2,1-3H3,(H,14,17)(H,18,19) |
| InChIKey | SNYYFJIRRAFZJO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|