C16H31NO7 — CID 100936346
[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(octylamino)-1-oxohexan-2-yl] acetate (PubChem CID 100936346) has the molecular formula C16H31NO7 and a molecular weight of 349.42 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(octylamino)-1-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(octylamino)-1-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 100936346 |
| Molecular Formula | C16H31NO7 |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-(octylamino)-1-oxohexan-2-yl] acetate |
| SMILES | CCCCCCCCNC(=O)[C@H](OC(C)=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C16H31NO7/c1-3-4-5-6-7-8-9-17-16(23)15(24-11(2)19)14(22)13(21)12(20)10-18/h12-15,18,20-22H,3-10H2,1-2H3,(H,17,23)/t12-,13-,14+,15-/m1/s1 |
| InChIKey | DCPZYQJFLCLNRE-APIJFGDWSA-N |
| XLogP | -0.53 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|