C16H17ClO7 — CID 25228257
[(3R,4S)-3,4-diacetyloxy-4-(4-chlorophenyl)-2-oxobutyl] acetate (PubChem CID 25228257) has the molecular formula C16H17ClO7 and a molecular weight of 356.76 g/mol. Its IUPAC name is [(3R,4S)-3,4-diacetyloxy-4-(4-chlorophenyl)-2-oxobutyl] acetate.
| Compound Name | [(3R,4S)-3,4-diacetyloxy-4-(4-chlorophenyl)-2-oxobutyl] acetate |
|---|---|
| PubChem CID | 25228257 |
| Molecular Formula | C16H17ClO7 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | [(3R,4S)-3,4-diacetyloxy-4-(4-chlorophenyl)-2-oxobutyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17ClO7/c1-9(18)22-8-14(21)16(24-11(3)20)15(23-10(2)19)12-4-6-13(17)7-5-12/h4-7,15-16H,8H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | AWGLYKSCLDWXKZ-HOTGVXAUSA-N |
| XLogP | 2.01 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|